C17H15BrClN3OS — CID 38930447
6-bromo-2-[(6-chloro-3-pyridinyl)methylsulfanyl]-3-propylquinazolin-4-one (PubChem CID 38930447) has the molecular formula C17H15BrClN3OS and a molecular weight of 424.75 g/mol. Its IUPAC name is 6-bromo-2-[(6-chloro-3-pyridinyl)methylsulfanyl]-3-propylquinazolin-4-one.
| Compound Name | 6-bromo-2-[(6-chloro-3-pyridinyl)methylsulfanyl]-3-propylquinazolin-4-one |
|---|---|
| PubChem CID | 38930447 |
| Molecular Formula | C17H15BrClN3OS |
| Molecular Weight | 424.75 g/mol |
| Exact Mass | 422.98 |
| IUPAC Name | 6-bromo-2-[(6-chloro-3-pyridinyl)methylsulfanyl]-3-propylquinazolin-4-one |
| SMILES | CCCn1c(SCc2ccc(Cl)nc2)nc2ccc(Br)cc2c1=O |
| InChI | InChI=1S/C17H15BrClN3OS/c1-2-7-22-16(23)13-8-12(18)4-5-14(13)21-17(22)24-10-11-3-6-15(19)20-9-11/h3-6,8-9H,2,7,10H2,1H3 |
| InChIKey | GMOYYWWNBZUFBM-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.75 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|