C23H20BrN3O2S — CID 60585759
6-bromo-3-ethyl-2-[[4-(pyridin-2-ylmethoxy)phenyl]methylsulfanyl]quinazolin-4-one (PubChem CID 60585759) has the molecular formula C23H20BrN3O2S and a molecular weight of 482.40 g/mol. Its IUPAC name is 6-bromo-3-ethyl-2-[[4-(pyridin-2-ylmethoxy)phenyl]methylsulfanyl]quinazolin-4-one.
| Compound Name | 6-bromo-3-ethyl-2-[[4-(pyridin-2-ylmethoxy)phenyl]methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 60585759 |
| Molecular Formula | C23H20BrN3O2S |
| Molecular Weight | 482.40 g/mol |
| Exact Mass | 481.05 |
| IUPAC Name | 6-bromo-3-ethyl-2-[[4-(pyridin-2-ylmethoxy)phenyl]methylsulfanyl]quinazolin-4-one |
| SMILES | CCn1c(SCc2ccc(OCc3ccccn3)cc2)nc2ccc(Br)cc2c1=O |
| InChI | InChI=1S/C23H20BrN3O2S/c1-2-27-22(28)20-13-17(24)8-11-21(20)26-23(27)30-15-16-6-9-19(10-7-16)29-14-18-5-3-4-12-25-18/h3-13H,2,14-15H2,1H3 |
| InChIKey | HMXZLPZMIYGEFJ-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.40 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |