C28H31N3O2S — CID 162670237
3-benzyl-2-benzylsulfanyl-6-[2-(diethylamino)ethoxy]quinazolin-4-one (PubChem CID 162670237) has the molecular formula C28H31N3O2S and a molecular weight of 473.64 g/mol. Its IUPAC name is 3-benzyl-2-benzylsulfanyl-6-[2-(diethylamino)ethoxy]quinazolin-4-one.
| Compound Name | 3-benzyl-2-benzylsulfanyl-6-[2-(diethylamino)ethoxy]quinazolin-4-one |
|---|---|
| PubChem CID | 162670237 |
| Molecular Formula | C28H31N3O2S |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 473.21 |
| IUPAC Name | 3-benzyl-2-benzylsulfanyl-6-[2-(diethylamino)ethoxy]quinazolin-4-one |
| SMILES | CCN(CC)CCOc1ccc2nc(SCc3ccccc3)n(Cc3ccccc3)c(=O)c2c1 |
| InChI | InChI=1S/C28H31N3O2S/c1-3-30(4-2)17-18-33-24-15-16-26-25(19-24)27(32)31(20-22-11-7-5-8-12-22)28(29-26)34-21-23-13-9-6-10-14-23/h5-16,19H,3-4,17-18,20-21H2,1-2H3 |
| InChIKey | JLSKQRSULBZTOV-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |