C24H22N2OS — CID 51365745
3-[(4-methylphenyl)methyl]-2-[(4-methylphenyl)methylsulfanyl]quinazolin-4-one (PubChem CID 51365745) has the molecular formula C24H22N2OS and a molecular weight of 386.52 g/mol. Its IUPAC name is 3-[(4-methylphenyl)methyl]-2-[(4-methylphenyl)methylsulfanyl]quinazolin-4-one.
| Compound Name | 3-[(4-methylphenyl)methyl]-2-[(4-methylphenyl)methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 51365745 |
| Molecular Formula | C24H22N2OS |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 3-[(4-methylphenyl)methyl]-2-[(4-methylphenyl)methylsulfanyl]quinazolin-4-one |
| SMILES | Cc1ccc(CSc2nc3ccccc3c(=O)n2Cc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H22N2OS/c1-17-7-11-19(12-8-17)15-26-23(27)21-5-3-4-6-22(21)25-24(26)28-16-20-13-9-18(2)10-14-20/h3-14H,15-16H2,1-2H3 |
| InChIKey | UDSOLMNKPVVIEA-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |