C24H22N2O2S — CID 51365410
3-[(4-methoxyphenyl)methyl]-2-[(3-methylphenyl)methylsulfanyl]quinazolin-4-one (PubChem CID 51365410) has the molecular formula C24H22N2O2S and a molecular weight of 402.52 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)methyl]-2-[(3-methylphenyl)methylsulfanyl]quinazolin-4-one.
| Compound Name | 3-[(4-methoxyphenyl)methyl]-2-[(3-methylphenyl)methylsulfanyl]quinazolin-4-one |
|---|---|
| PubChem CID | 51365410 |
| Molecular Formula | C24H22N2O2S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | 3-[(4-methoxyphenyl)methyl]-2-[(3-methylphenyl)methylsulfanyl]quinazolin-4-one |
| SMILES | COc1ccc(Cn2c(SCc3cccc(C)c3)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C24H22N2O2S/c1-17-6-5-7-19(14-17)16-29-24-25-22-9-4-3-8-21(22)23(27)26(24)15-18-10-12-20(28-2)13-11-18/h3-14H,15-16H2,1-2H3 |
| InChIKey | DMSKPOXJZTWLAX-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |