C24H19N3OS — CID 3895934
2-[[3-[(4-methylphenyl)methyl]-4-oxoquinazolin-2-yl]sulfanylmethyl]benzonitrile (PubChem CID 3895934) has the molecular formula C24H19N3OS and a molecular weight of 397.50 g/mol. Its IUPAC name is 2-[[3-[(4-methylphenyl)methyl]-4-oxoquinazolin-2-yl]sulfanylmethyl]benzonitrile.
| Compound Name | 2-[[3-[(4-methylphenyl)methyl]-4-oxoquinazolin-2-yl]sulfanylmethyl]benzonitrile |
|---|---|
| PubChem CID | 3895934 |
| Molecular Formula | C24H19N3OS |
| Molecular Weight | 397.50 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 2-[[3-[(4-methylphenyl)methyl]-4-oxoquinazolin-2-yl]sulfanylmethyl]benzonitrile |
| SMILES | Cc1ccc(Cn2c(SCc3ccccc3C#N)nc3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C24H19N3OS/c1-17-10-12-18(13-11-17)15-27-23(28)21-8-4-5-9-22(21)26-24(27)29-16-20-7-3-2-6-19(20)14-25/h2-13H,15-16H2,1H3 |
| InChIKey | KZPXRKIPNNXSQO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |