C21H22BrN3O2S — CID 2980769
2-(3-benzyl-6-bromo-4-oxoquinazolin-2-yl)sulfanyl-N,N-diethylacetamide (PubChem CID 2980769) has the molecular formula C21H22BrN3O2S and a molecular weight of 460.40 g/mol. Its IUPAC name is 2-(3-benzyl-6-bromo-4-oxoquinazolin-2-yl)sulfanyl-N,N-diethylacetamide.
| Compound Name | 2-(3-benzyl-6-bromo-4-oxoquinazolin-2-yl)sulfanyl-N,N-diethylacetamide |
|---|---|
| PubChem CID | 2980769 |
| Molecular Formula | C21H22BrN3O2S |
| Molecular Weight | 460.40 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | 2-(3-benzyl-6-bromo-4-oxoquinazolin-2-yl)sulfanyl-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CSc1nc2ccc(Br)cc2c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C21H22BrN3O2S/c1-3-24(4-2)19(26)14-28-21-23-18-11-10-16(22)12-17(18)20(27)25(21)13-15-8-6-5-7-9-15/h5-12H,3-4,13-14H2,1-2H3 |
| InChIKey | LCCFQVCPNZTARA-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.40 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |