C16H17BrN2O3S — CID 1291119
ethyl 2-[6-bromo-3-(2-methylprop-2-enyl)-4-oxoquinazolin-2-yl]sulfanylacetate (PubChem CID 1291119) has the molecular formula C16H17BrN2O3S and a molecular weight of 397.29 g/mol. Its IUPAC name is ethyl 2-[6-bromo-3-(2-methylprop-2-enyl)-4-oxoquinazolin-2-yl]sulfanylacetate.
| Compound Name | ethyl 2-[6-bromo-3-(2-methylprop-2-enyl)-4-oxoquinazolin-2-yl]sulfanylacetate |
|---|---|
| PubChem CID | 1291119 |
| Molecular Formula | C16H17BrN2O3S |
| Molecular Weight | 397.29 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | ethyl 2-[6-bromo-3-(2-methylprop-2-enyl)-4-oxoquinazolin-2-yl]sulfanylacetate |
| SMILES | C=C(C)Cn1c(SCC(=O)OCC)nc2ccc(Br)cc2c1=O |
| InChI | InChI=1S/C16H17BrN2O3S/c1-4-22-14(20)9-23-16-18-13-6-5-11(17)7-12(13)15(21)19(16)8-10(2)3/h5-7H,2,4,8-9H2,1,3H3 |
| InChIKey | NWXGUCUIGNOJHV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.29 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|