C21H19BrN4O3S — CID 1243022
N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[3-(2-methylprop-2-enyl)-4-oxoquinazolin-2-yl]sulfanylacetamide (PubChem CID 1243022) has the molecular formula C21H19BrN4O3S and a molecular weight of 487.38 g/mol. Its IUPAC name is N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[3-(2-methylprop-2-enyl)-4-oxoquinazolin-2-yl]sulfanylacetamide.
| Compound Name | N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[3-(2-methylprop-2-enyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 1243022 |
| Molecular Formula | C21H19BrN4O3S |
| Molecular Weight | 487.38 g/mol |
| Exact Mass | 486.04 |
| IUPAC Name | N-[(5-bromo-2-hydroxyphenyl)methylideneamino]-2-[3-(2-methylprop-2-enyl)-4-oxoquinazolin-2-yl]sulfanylacetamide |
| SMILES | C=C(C)Cn1c(SCC(=O)NN=Cc2cc(Br)ccc2O)nc2ccccc2c1=O |
| InChI | InChI=1S/C21H19BrN4O3S/c1-13(2)11-26-20(29)16-5-3-4-6-17(16)24-21(26)30-12-19(28)25-23-10-14-9-15(22)7-8-18(14)27/h3-10,27H,1,11-12H2,2H3,(H,25,28) |
| InChIKey | HRPOGKNKRFUTNO-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.38 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|