C20H19BrN2O3S — CID 31804431
6-bromo-3-(2-methoxyethyl)-2-[2-(4-methylphenyl)-2-oxoethyl]sulfanylquinazolin-4-one (PubChem CID 31804431) has the molecular formula C20H19BrN2O3S and a molecular weight of 447.35 g/mol. Its IUPAC name is 6-bromo-3-(2-methoxyethyl)-2-[2-(4-methylphenyl)-2-oxoethyl]sulfanylquinazolin-4-one.
| Compound Name | 6-bromo-3-(2-methoxyethyl)-2-[2-(4-methylphenyl)-2-oxoethyl]sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 31804431 |
| Molecular Formula | C20H19BrN2O3S |
| Molecular Weight | 447.35 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | 6-bromo-3-(2-methoxyethyl)-2-[2-(4-methylphenyl)-2-oxoethyl]sulfanylquinazolin-4-one |
| SMILES | COCCn1c(SCC(=O)c2ccc(C)cc2)nc2ccc(Br)cc2c1=O |
| InChI | InChI=1S/C20H19BrN2O3S/c1-13-3-5-14(6-4-13)18(24)12-27-20-22-17-8-7-15(21)11-16(17)19(25)23(20)9-10-26-2/h3-8,11H,9-10,12H2,1-2H3 |
| InChIKey | XFXOTNPQBLSQTF-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.35 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |