C17H15BrClN3O2S — CID 55525202
6-bromo-2-[(6-chloro-3-pyridinyl)methylsulfanyl]-3-(2-methoxyethyl)quinazolin-4-one (PubChem CID 55525202) has the molecular formula C17H15BrClN3O2S and a molecular weight of 440.75 g/mol. Its IUPAC name is 6-bromo-2-[(6-chloro-3-pyridinyl)methylsulfanyl]-3-(2-methoxyethyl)quinazolin-4-one.
| Compound Name | 6-bromo-2-[(6-chloro-3-pyridinyl)methylsulfanyl]-3-(2-methoxyethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 55525202 |
| Molecular Formula | C17H15BrClN3O2S |
| Molecular Weight | 440.75 g/mol |
| Exact Mass | 438.98 |
| IUPAC Name | 6-bromo-2-[(6-chloro-3-pyridinyl)methylsulfanyl]-3-(2-methoxyethyl)quinazolin-4-one |
| SMILES | COCCn1c(SCc2ccc(Cl)nc2)nc2ccc(Br)cc2c1=O |
| InChI | InChI=1S/C17H15BrClN3O2S/c1-24-7-6-22-16(23)13-8-12(18)3-4-14(13)21-17(22)25-10-11-2-5-15(19)20-9-11/h2-5,8-9H,6-7,10H2,1H3 |
| InChIKey | YDDFLMASOKTEIP-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.75 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|