C11H12BrN3O2 — CID 67981775
2-amino-6-bromo-3-(2-methoxyethyl)quinazolin-4-one (PubChem CID 67981775) has the molecular formula C11H12BrN3O2 and a molecular weight of 298.14 g/mol. Its IUPAC name is 2-amino-6-bromo-3-(2-methoxyethyl)quinazolin-4-one.
| Compound Name | 2-amino-6-bromo-3-(2-methoxyethyl)quinazolin-4-one |
|---|---|
| PubChem CID | 67981775 |
| Molecular Formula | C11H12BrN3O2 |
| Molecular Weight | 298.14 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 2-amino-6-bromo-3-(2-methoxyethyl)quinazolin-4-one |
| SMILES | COCCn1c(N)nc2ccc(Br)cc2c1=O |
| InChI | InChI=1S/C11H12BrN3O2/c1-17-5-4-15-10(16)8-6-7(12)2-3-9(8)14-11(15)13/h2-3,6H,4-5H2,1H3,(H2,13,14) |
| InChIKey | SIWWEXWHBYKQRC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.14 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |