C15H16BrN3O2S — CID 177325801
2-(6-bromo-4-oxo-2-prop-2-enylsulfanylquinazolin-3-yl)-N,N-dimethylacetamide (PubChem CID 177325801) has the molecular formula C15H16BrN3O2S and a molecular weight of 382.28 g/mol. Its IUPAC name is 2-(6-bromo-4-oxo-2-prop-2-enylsulfanylquinazolin-3-yl)-N,N-dimethylacetamide.
| Compound Name | 2-(6-bromo-4-oxo-2-prop-2-enylsulfanylquinazolin-3-yl)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 177325801 |
| Molecular Formula | C15H16BrN3O2S |
| Molecular Weight | 382.28 g/mol |
| Exact Mass | 381.01 |
| IUPAC Name | 2-(6-bromo-4-oxo-2-prop-2-enylsulfanylquinazolin-3-yl)-N,N-dimethylacetamide |
| SMILES | C=CCSc1nc2ccc(Br)cc2c(=O)n1CC(=O)N(C)C |
| InChI | InChI=1S/C15H16BrN3O2S/c1-4-7-22-15-17-12-6-5-10(16)8-11(12)14(21)19(15)9-13(20)18(2)3/h4-6,8H,1,7,9H2,2-3H3 |
| InChIKey | FDBBOMFAHNIKEU-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.28 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|