C19H22BrN3O2S — CID 2978446
6-bromo-3-(2-methylprop-2-enyl)-2-(2-oxo-2-piperidin-1-ylethyl)sulfanylquinazolin-4-one (PubChem CID 2978446) has the molecular formula C19H22BrN3O2S and a molecular weight of 436.38 g/mol. Its IUPAC name is 6-bromo-3-(2-methylprop-2-enyl)-2-(2-oxo-2-piperidin-1-ylethyl)sulfanylquinazolin-4-one.
| Compound Name | 6-bromo-3-(2-methylprop-2-enyl)-2-(2-oxo-2-piperidin-1-ylethyl)sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 2978446 |
| Molecular Formula | C19H22BrN3O2S |
| Molecular Weight | 436.38 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | 6-bromo-3-(2-methylprop-2-enyl)-2-(2-oxo-2-piperidin-1-ylethyl)sulfanylquinazolin-4-one |
| SMILES | C=C(C)Cn1c(SCC(=O)N2CCCCC2)nc2ccc(Br)cc2c1=O |
| InChI | InChI=1S/C19H22BrN3O2S/c1-13(2)11-23-18(25)15-10-14(20)6-7-16(15)21-19(23)26-12-17(24)22-8-4-3-5-9-22/h6-7,10H,1,3-5,8-9,11-12H2,2H3 |
| InChIKey | DUFSZJDSHGOIJD-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|