C22H22BrN3O3S — CID 6456841
6-bromo-3-(4-methoxyphenyl)-2-(2-oxo-2-piperidin-1-ylethyl)sulfanylquinazolin-4-one (PubChem CID 6456841) has the molecular formula C22H22BrN3O3S and a molecular weight of 488.41 g/mol. Its IUPAC name is 6-bromo-3-(4-methoxyphenyl)-2-(2-oxo-2-piperidin-1-ylethyl)sulfanylquinazolin-4-one.
| Compound Name | 6-bromo-3-(4-methoxyphenyl)-2-(2-oxo-2-piperidin-1-ylethyl)sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 6456841 |
| Molecular Formula | C22H22BrN3O3S |
| Molecular Weight | 488.41 g/mol |
| Exact Mass | 487.06 |
| IUPAC Name | 6-bromo-3-(4-methoxyphenyl)-2-(2-oxo-2-piperidin-1-ylethyl)sulfanylquinazolin-4-one |
| SMILES | COc1ccc(-n2c(SCC(=O)N3CCCCC3)nc3ccc(Br)cc3c2=O)cc1 |
| InChI | InChI=1S/C22H22BrN3O3S/c1-29-17-8-6-16(7-9-17)26-21(28)18-13-15(23)5-10-19(18)24-22(26)30-14-20(27)25-11-3-2-4-12-25/h5-10,13H,2-4,11-12,14H2,1H3 |
| InChIKey | UPHATUZTLVKQBK-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.41 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |