C20H24IN3O2S — CID 2959841
6-iodo-3-(2-methylprop-2-enyl)-2-(1-oxo-1-piperidin-1-ylpropan-2-yl)sulfanylquinazolin-4-one (PubChem CID 2959841) has the molecular formula C20H24IN3O2S and a molecular weight of 497.40 g/mol. Its IUPAC name is 6-iodo-3-(2-methylprop-2-enyl)-2-(1-oxo-1-piperidin-1-ylpropan-2-yl)sulfanylquinazolin-4-one.
| Compound Name | 6-iodo-3-(2-methylprop-2-enyl)-2-(1-oxo-1-piperidin-1-ylpropan-2-yl)sulfanylquinazolin-4-one |
|---|---|
| PubChem CID | 2959841 |
| Molecular Formula | C20H24IN3O2S |
| Molecular Weight | 497.40 g/mol |
| Exact Mass | 497.06 |
| IUPAC Name | 6-iodo-3-(2-methylprop-2-enyl)-2-(1-oxo-1-piperidin-1-ylpropan-2-yl)sulfanylquinazolin-4-one |
| SMILES | C=C(C)Cn1c(SC(C)C(=O)N2CCCCC2)nc2ccc(I)cc2c1=O |
| InChI | InChI=1S/C20H24IN3O2S/c1-13(2)12-24-19(26)16-11-15(21)7-8-17(16)22-20(24)27-14(3)18(25)23-9-5-4-6-10-23/h7-8,11,14H,1,4-6,9-10,12H2,2-3H3 |
| InChIKey | YEGHXRZDRXZYQS-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|