C18H21N3O3S — CID 40804022
2-[(2S)-1-morpholin-4-yl-1-oxopropan-2-yl]sulfanyl-3-prop-2-enylquinazolin-4-one (PubChem CID 40804022) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is 2-[(2S)-1-morpholin-4-yl-1-oxopropan-2-yl]sulfanyl-3-prop-2-enylquinazolin-4-one.
| Compound Name | 2-[(2S)-1-morpholin-4-yl-1-oxopropan-2-yl]sulfanyl-3-prop-2-enylquinazolin-4-one |
|---|---|
| PubChem CID | 40804022 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 2-[(2S)-1-morpholin-4-yl-1-oxopropan-2-yl]sulfanyl-3-prop-2-enylquinazolin-4-one |
| SMILES | C=CCn1c(S[C@@H](C)C(=O)N2CCOCC2)nc2ccccc2c1=O |
| InChI | InChI=1S/C18H21N3O3S/c1-3-8-21-17(23)14-6-4-5-7-15(14)19-18(21)25-13(2)16(22)20-9-11-24-12-10-20/h3-7,13H,1,8-12H2,2H3/t13-/m0/s1 |
| InChIKey | BXKKKHOUPRJFSB-ZDUSSCGKSA-N |
| XLogP | 1.92 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|