C20H16F2N2O2S — CID 9407437
2-[(2R)-1-(3,4-difluorophenyl)-1-oxopropan-2-yl]sulfanyl-3-prop-2-enylquinazolin-4-one (PubChem CID 9407437) has the molecular formula C20H16F2N2O2S and a molecular weight of 386.42 g/mol. Its IUPAC name is 2-[(2R)-1-(3,4-difluorophenyl)-1-oxopropan-2-yl]sulfanyl-3-prop-2-enylquinazolin-4-one.
| Compound Name | 2-[(2R)-1-(3,4-difluorophenyl)-1-oxopropan-2-yl]sulfanyl-3-prop-2-enylquinazolin-4-one |
|---|---|
| PubChem CID | 9407437 |
| Molecular Formula | C20H16F2N2O2S |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | 2-[(2R)-1-(3,4-difluorophenyl)-1-oxopropan-2-yl]sulfanyl-3-prop-2-enylquinazolin-4-one |
| SMILES | C=CCn1c(S[C@H](C)C(=O)c2ccc(F)c(F)c2)nc2ccccc2c1=O |
| InChI | InChI=1S/C20H16F2N2O2S/c1-3-10-24-19(26)14-6-4-5-7-17(14)23-20(24)27-12(2)18(25)13-8-9-15(21)16(22)11-13/h3-9,11-12H,1,10H2,2H3/t12-/m1/s1 |
| InChIKey | XRQQEUOJEDGGSV-GFCCVEGCSA-N |
| XLogP | 4.22 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|