C20H17F2N3OS — CID 7168853
(2R)-1-(3,4-difluorophenyl)-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-one (PubChem CID 7168853) has the molecular formula C20H17F2N3OS and a molecular weight of 385.44 g/mol. Its IUPAC name is (2R)-1-(3,4-difluorophenyl)-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-one.
| Compound Name | (2R)-1-(3,4-difluorophenyl)-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-one |
|---|---|
| PubChem CID | 7168853 |
| Molecular Formula | C20H17F2N3OS |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | (2R)-1-(3,4-difluorophenyl)-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-one |
| SMILES | C=CCn1c(S[C@H](C)C(=O)c2ccc(F)c(F)c2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C20H17F2N3OS/c1-3-11-25-19(14-7-5-4-6-8-14)23-24-20(25)27-13(2)18(26)15-9-10-16(21)17(22)12-15/h3-10,12-13H,1,11H2,2H3/t13-/m1/s1 |
| InChIKey | HGJREOQAYXGGSQ-CYBMUJFWSA-N |
| XLogP | 4.77 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|