C20H18FN3OS — CID 7168968
(2S)-1-(4-fluorophenyl)-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-one (PubChem CID 7168968) has the molecular formula C20H18FN3OS and a molecular weight of 367.45 g/mol. Its IUPAC name is (2S)-1-(4-fluorophenyl)-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-one.
| Compound Name | (2S)-1-(4-fluorophenyl)-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-one |
|---|---|
| PubChem CID | 7168968 |
| Molecular Formula | C20H18FN3OS |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | (2S)-1-(4-fluorophenyl)-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-one |
| SMILES | C=CCn1c(S[C@@H](C)C(=O)c2ccc(F)cc2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C20H18FN3OS/c1-3-13-24-19(16-7-5-4-6-8-16)22-23-20(24)26-14(2)18(25)15-9-11-17(21)12-10-15/h3-12,14H,1,13H2,2H3/t14-/m0/s1 |
| InChIKey | PLHYJNDMJBNHFM-AWEZNQCLSA-N |
| XLogP | 4.63 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|