C21H20FN5O2S — CID 4779787
4-[2-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]benzamide (PubChem CID 4779787) has the molecular formula C21H20FN5O2S and a molecular weight of 425.49 g/mol. Its IUPAC name is 4-[2-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]benzamide.
| Compound Name | 4-[2-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]benzamide |
|---|---|
| PubChem CID | 4779787 |
| Molecular Formula | C21H20FN5O2S |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.13 |
| IUPAC Name | 4-[2-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanoylamino]benzamide |
| SMILES | C=CCn1c(SC(C)C(=O)Nc2ccc(C(N)=O)cc2)nnc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C21H20FN5O2S/c1-3-12-27-19(15-4-8-16(22)9-5-15)25-26-21(27)30-13(2)20(29)24-17-10-6-14(7-11-17)18(23)28/h3-11,13H,1,12H2,2H3,(H2,23,28)(H,24,29) |
| InChIKey | BAXBGCDZNFPBKM-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|