C20H18ClFN4OS — CID 8851959
(2S)-N-(2-chlorophenyl)-2-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 8851959) has the molecular formula C20H18ClFN4OS and a molecular weight of 416.91 g/mol. Its IUPAC name is (2S)-N-(2-chlorophenyl)-2-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | (2S)-N-(2-chlorophenyl)-2-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 8851959 |
| Molecular Formula | C20H18ClFN4OS |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | (2S)-N-(2-chlorophenyl)-2-[[5-(4-fluorophenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | C=CCn1c(S[C@@H](C)C(=O)Nc2ccccc2Cl)nnc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C20H18ClFN4OS/c1-3-12-26-18(14-8-10-15(22)11-9-14)24-25-20(26)28-13(2)19(27)23-17-7-5-4-6-16(17)21/h3-11,13H,1,12H2,2H3,(H,23,27)/t13-/m0/s1 |
| InChIKey | BTGSKFVJQJGHCO-ZDUSSCGKSA-N |
| XLogP | 5.04 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|