C22H23N3O3S — CID 7813854
(2R)-1-(4-methoxyphenyl)-2-[[5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propan-1-one (PubChem CID 7813854) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is (2R)-1-(4-methoxyphenyl)-2-[[5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propan-1-one.
| Compound Name | (2R)-1-(4-methoxyphenyl)-2-[[5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propan-1-one |
|---|---|
| PubChem CID | 7813854 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | (2R)-1-(4-methoxyphenyl)-2-[[5-(4-methoxyphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propan-1-one |
| SMILES | C=CCn1c(S[C@H](C)C(=O)c2ccc(OC)cc2)nnc1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H23N3O3S/c1-5-14-25-21(17-8-12-19(28-4)13-9-17)23-24-22(25)29-15(2)20(26)16-6-10-18(27-3)11-7-16/h5-13,15H,1,14H2,2-4H3/t15-/m1/s1 |
| InChIKey | DIHPPVYFFFOBCE-OAHLLOKOSA-N |
| XLogP | 4.51 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|