C22H23N3OS — CID 112774898
1-(4-ethylphenyl)-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-one (PubChem CID 112774898) has the molecular formula C22H23N3OS and a molecular weight of 377.51 g/mol. Its IUPAC name is 1-(4-ethylphenyl)-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-one.
| Compound Name | 1-(4-ethylphenyl)-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-one |
|---|---|
| PubChem CID | 112774898 |
| Molecular Formula | C22H23N3OS |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 1-(4-ethylphenyl)-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propan-1-one |
| SMILES | C=CCn1c(SC(C)C(=O)c2ccc(CC)cc2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C22H23N3OS/c1-4-15-25-21(19-9-7-6-8-10-19)23-24-22(25)27-16(3)20(26)18-13-11-17(5-2)12-14-18/h4,6-14,16H,1,5,15H2,2-3H3 |
| InChIKey | ZVSMMPVDLSLGGI-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|