C23H25N5O2S — CID 78826898
N-[2-[4-[2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]propanoyl]phenyl]ethyl]acetamide (PubChem CID 78826898) has the molecular formula C23H25N5O2S and a molecular weight of 435.55 g/mol. Its IUPAC name is N-[2-[4-[2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]propanoyl]phenyl]ethyl]acetamide.
| Compound Name | N-[2-[4-[2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]propanoyl]phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 78826898 |
| Molecular Formula | C23H25N5O2S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | N-[2-[4-[2-[(4-prop-2-enyl-5-pyridin-4-yl-1,2,4-triazol-3-yl)sulfanyl]propanoyl]phenyl]ethyl]acetamide |
| SMILES | C=CCn1c(SC(C)C(=O)c2ccc(CCNC(C)=O)cc2)nnc1-c1ccncc1 |
| InChI | InChI=1S/C23H25N5O2S/c1-4-15-28-22(20-10-12-24-13-11-20)26-27-23(28)31-16(2)21(30)19-7-5-18(6-8-19)9-14-25-17(3)29/h4-8,10-13,16H,1,9,14-15H2,2-3H3,(H,25,29) |
| InChIKey | IKAUDFQAUPSFLP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|