C14H15N3O2S — CID 9487024
(2S)-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanoic acid (PubChem CID 9487024) has the molecular formula C14H15N3O2S and a molecular weight of 289.36 g/mol. Its IUPAC name is (2S)-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanoic acid.
| Compound Name | (2S)-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 9487024 |
| Molecular Formula | C14H15N3O2S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | (2S)-2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]propanoic acid |
| SMILES | C=CCn1c(S[C@@H](C)C(=O)O)nnc1-c1ccccc1 |
| InChI | InChI=1S/C14H15N3O2S/c1-3-9-17-12(11-7-5-4-6-8-11)15-16-14(17)20-10(2)13(18)19/h3-8,10H,1,9H2,2H3,(H,18,19)/t10-/m0/s1 |
| InChIKey | JYRRYQKQIDRABE-JTQLQIEISA-N |
| XLogP | 2.70 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|