C21H19ClN2O2S — CID 2487800
6-chloro-2-[(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl]sulfanyl-3-prop-2-enylquinazolin-4-one (PubChem CID 2487800) has the molecular formula C21H19ClN2O2S and a molecular weight of 398.92 g/mol. Its IUPAC name is 6-chloro-2-[(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl]sulfanyl-3-prop-2-enylquinazolin-4-one.
| Compound Name | 6-chloro-2-[(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl]sulfanyl-3-prop-2-enylquinazolin-4-one |
|---|---|
| PubChem CID | 2487800 |
| Molecular Formula | C21H19ClN2O2S |
| Molecular Weight | 398.92 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 6-chloro-2-[(2S)-1-(4-methylphenyl)-1-oxopropan-2-yl]sulfanyl-3-prop-2-enylquinazolin-4-one |
| SMILES | C=CCn1c(S[C@@H](C)C(=O)c2ccc(C)cc2)nc2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C21H19ClN2O2S/c1-4-11-24-20(26)17-12-16(22)9-10-18(17)23-21(24)27-14(3)19(25)15-7-5-13(2)6-8-15/h4-10,12,14H,1,11H2,2-3H3/t14-/m0/s1 |
| InChIKey | PTIAUZBGLDBKCZ-AWEZNQCLSA-N |
| XLogP | 4.91 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.92 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|