C20H19ClN4O4S2 — CID 2563082
(2R)-2-(6-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(4-sulfamoylphenyl)propanamide (PubChem CID 2563082) has the molecular formula C20H19ClN4O4S2 and a molecular weight of 478.98 g/mol. Its IUPAC name is (2R)-2-(6-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | (2R)-2-(6-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 2563082 |
| Molecular Formula | C20H19ClN4O4S2 |
| Molecular Weight | 478.98 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | (2R)-2-(6-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(4-sulfamoylphenyl)propanamide |
| SMILES | C=CCn1c(S[C@H](C)C(=O)Nc2ccc(S(N)(=O)=O)cc2)nc2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C20H19ClN4O4S2/c1-3-10-25-19(27)16-11-13(21)4-9-17(16)24-20(25)30-12(2)18(26)23-14-5-7-15(8-6-14)31(22,28)29/h3-9,11-12H,1,10H2,2H3,(H,23,26)(H2,22,28,29)/t12-/m1/s1 |
| InChIKey | SBLQXINFICWUFQ-GFCCVEGCSA-N |
| XLogP | 3.00 |
| TPSA | 124.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.98 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|