C15H15ClN2O3S — CID 7691801
methyl (2S)-2-(6-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylpropanoate (PubChem CID 7691801) has the molecular formula C15H15ClN2O3S and a molecular weight of 338.82 g/mol. Its IUPAC name is methyl (2S)-2-(6-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylpropanoate.
| Compound Name | methyl (2S)-2-(6-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylpropanoate |
|---|---|
| PubChem CID | 7691801 |
| Molecular Formula | C15H15ClN2O3S |
| Molecular Weight | 338.82 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | methyl (2S)-2-(6-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylpropanoate |
| SMILES | C=CCn1c(S[C@@H](C)C(=O)OC)nc2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C15H15ClN2O3S/c1-4-7-18-13(19)11-8-10(16)5-6-12(11)17-15(18)22-9(2)14(20)21-3/h4-6,8-9H,1,7H2,2-3H3/t9-/m0/s1 |
| InChIKey | RMOIHFFICIDHQM-VIFPVBQESA-N |
| XLogP | 2.89 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.82 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|