C23H21ClN4O2S — CID 4819433
2-(6-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(2-cyanoethyl)-N-phenylpropanamide (PubChem CID 4819433) has the molecular formula C23H21ClN4O2S and a molecular weight of 452.97 g/mol. Its IUPAC name is 2-(6-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(2-cyanoethyl)-N-phenylpropanamide.
| Compound Name | 2-(6-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(2-cyanoethyl)-N-phenylpropanamide |
|---|---|
| PubChem CID | 4819433 |
| Molecular Formula | C23H21ClN4O2S |
| Molecular Weight | 452.97 g/mol |
| Exact Mass | 452.11 |
| IUPAC Name | 2-(6-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(2-cyanoethyl)-N-phenylpropanamide |
| SMILES | C=CCn1c(SC(C)C(=O)N(CCC#N)c2ccccc2)nc2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C23H21ClN4O2S/c1-3-13-28-22(30)19-15-17(24)10-11-20(19)26-23(28)31-16(2)21(29)27(14-7-12-25)18-8-5-4-6-9-18/h3-6,8-11,15-16H,1,7,13-14H2,2H3 |
| InChIKey | RVKAJMXSCUSXQJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 78.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.97 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|