C14H12ClN3OS — CID 2487836
(2R)-2-(6-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylpropanenitrile (PubChem CID 2487836) has the molecular formula C14H12ClN3OS and a molecular weight of 305.79 g/mol. Its IUPAC name is (2R)-2-(6-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylpropanenitrile.
| Compound Name | (2R)-2-(6-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylpropanenitrile |
|---|---|
| PubChem CID | 2487836 |
| Molecular Formula | C14H12ClN3OS |
| Molecular Weight | 305.79 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | (2R)-2-(6-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylpropanenitrile |
| SMILES | C=CCn1c(S[C@H](C)C#N)nc2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C14H12ClN3OS/c1-3-6-18-13(19)11-7-10(15)4-5-12(11)17-14(18)20-9(2)8-16/h3-5,7,9H,1,6H2,2H3/t9-/m1/s1 |
| InChIKey | XVXKSAWSTMNHRD-SECBINFHSA-N |
| XLogP | 3.24 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.79 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|