C17H19ClN4O3S — CID 7691781
(2R)-N-carbamoyl-2-(6-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-3-methylbutanamide (PubChem CID 7691781) has the molecular formula C17H19ClN4O3S and a molecular weight of 394.88 g/mol. Its IUPAC name is (2R)-N-carbamoyl-2-(6-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-3-methylbutanamide.
| Compound Name | (2R)-N-carbamoyl-2-(6-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-3-methylbutanamide |
|---|---|
| PubChem CID | 7691781 |
| Molecular Formula | C17H19ClN4O3S |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | (2R)-N-carbamoyl-2-(6-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-3-methylbutanamide |
| SMILES | C=CCn1c(S[C@@H](C(=O)NC(N)=O)C(C)C)nc2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C17H19ClN4O3S/c1-4-7-22-15(24)11-8-10(18)5-6-12(11)20-17(22)26-13(9(2)3)14(23)21-16(19)25/h4-6,8-9,13H,1,7H2,2-3H3,(H3,19,21,23,25)/t13-/m1/s1 |
| InChIKey | KBMRFOXGPYRUHB-CYBMUJFWSA-N |
| XLogP | 2.55 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|