C15H16ClN3O2S — CID 2487705
2-(6-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-ethylacetamide (PubChem CID 2487705) has the molecular formula C15H16ClN3O2S and a molecular weight of 337.83 g/mol. Its IUPAC name is 2-(6-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-ethylacetamide.
| Compound Name | 2-(6-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-ethylacetamide |
|---|---|
| PubChem CID | 2487705 |
| Molecular Formula | C15H16ClN3O2S |
| Molecular Weight | 337.83 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 2-(6-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-ethylacetamide |
| SMILES | C=CCn1c(SCC(=O)NCC)nc2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C15H16ClN3O2S/c1-3-7-19-14(21)11-8-10(16)5-6-12(11)18-15(19)22-9-13(20)17-4-2/h3,5-6,8H,1,4,7,9H2,2H3,(H,17,20) |
| InChIKey | BNKSDQXYDPAHIG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.83 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|