C20H24ClN3O2S — CID 16504836
2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(cyclohexylmethyl)acetamide (PubChem CID 16504836) has the molecular formula C20H24ClN3O2S and a molecular weight of 405.95 g/mol. Its IUPAC name is 2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(cyclohexylmethyl)acetamide.
| Compound Name | 2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(cyclohexylmethyl)acetamide |
|---|---|
| PubChem CID | 16504836 |
| Molecular Formula | C20H24ClN3O2S |
| Molecular Weight | 405.95 g/mol |
| Exact Mass | 405.13 |
| IUPAC Name | 2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(cyclohexylmethyl)acetamide |
| SMILES | C=CCn1c(SCC(=O)NCC2CCCCC2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C20H24ClN3O2S/c1-2-10-24-19(26)16-9-8-15(21)11-17(16)23-20(24)27-13-18(25)22-12-14-6-4-3-5-7-14/h2,8-9,11,14H,1,3-7,10,12-13H2,(H,22,25) |
| InChIKey | UCVRDRXFZIKVFO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.95 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|