C19H22ClN3O2S — CID 2530674
2-(7-chloro-3-cyclohexyl-4-oxoquinazolin-2-yl)sulfanyl-N-prop-2-enylacetamide (PubChem CID 2530674) has the molecular formula C19H22ClN3O2S and a molecular weight of 391.92 g/mol. Its IUPAC name is 2-(7-chloro-3-cyclohexyl-4-oxoquinazolin-2-yl)sulfanyl-N-prop-2-enylacetamide.
| Compound Name | 2-(7-chloro-3-cyclohexyl-4-oxoquinazolin-2-yl)sulfanyl-N-prop-2-enylacetamide |
|---|---|
| PubChem CID | 2530674 |
| Molecular Formula | C19H22ClN3O2S |
| Molecular Weight | 391.92 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 2-(7-chloro-3-cyclohexyl-4-oxoquinazolin-2-yl)sulfanyl-N-prop-2-enylacetamide |
| SMILES | C=CCNC(=O)CSc1nc2cc(Cl)ccc2c(=O)n1C1CCCCC1 |
| InChI | InChI=1S/C19H22ClN3O2S/c1-2-10-21-17(24)12-26-19-22-16-11-13(20)8-9-15(16)18(25)23(19)14-6-4-3-5-7-14/h2,8-9,11,14H,1,3-7,10,12H2,(H,21,24) |
| InChIKey | XRVMXFRWTFRISA-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.92 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|