C21H19Cl2N3O2S — CID 2418977
2-(7-chloro-3-cyclopentyl-4-oxoquinazolin-2-yl)sulfanyl-N-(3-chlorophenyl)acetamide (PubChem CID 2418977) has the molecular formula C21H19Cl2N3O2S and a molecular weight of 448.38 g/mol. Its IUPAC name is 2-(7-chloro-3-cyclopentyl-4-oxoquinazolin-2-yl)sulfanyl-N-(3-chlorophenyl)acetamide.
| Compound Name | 2-(7-chloro-3-cyclopentyl-4-oxoquinazolin-2-yl)sulfanyl-N-(3-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 2418977 |
| Molecular Formula | C21H19Cl2N3O2S |
| Molecular Weight | 448.38 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | 2-(7-chloro-3-cyclopentyl-4-oxoquinazolin-2-yl)sulfanyl-N-(3-chlorophenyl)acetamide |
| SMILES | O=C(CSc1nc2cc(Cl)ccc2c(=O)n1C1CCCC1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C21H19Cl2N3O2S/c22-13-4-3-5-15(10-13)24-19(27)12-29-21-25-18-11-14(23)8-9-17(18)20(28)26(21)16-6-1-2-7-16/h3-5,8-11,16H,1-2,6-7,12H2,(H,24,27) |
| InChIKey | LWCLHWKDAMBWFD-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.38 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |