C23H23N3O3S — CID 7988583
N-(3-acetylphenyl)-2-(3-cyclopentyl-4-oxoquinazolin-2-yl)sulfanylacetamide (PubChem CID 7988583) has the molecular formula C23H23N3O3S and a molecular weight of 421.52 g/mol. Its IUPAC name is N-(3-acetylphenyl)-2-(3-cyclopentyl-4-oxoquinazolin-2-yl)sulfanylacetamide.
| Compound Name | N-(3-acetylphenyl)-2-(3-cyclopentyl-4-oxoquinazolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 7988583 |
| Molecular Formula | C23H23N3O3S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | N-(3-acetylphenyl)-2-(3-cyclopentyl-4-oxoquinazolin-2-yl)sulfanylacetamide |
| SMILES | CC(=O)c1cccc(NC(=O)CSc2nc3ccccc3c(=O)n2C2CCCC2)c1 |
| InChI | InChI=1S/C23H23N3O3S/c1-15(27)16-7-6-8-17(13-16)24-21(28)14-30-23-25-20-12-5-4-11-19(20)22(29)26(23)18-9-2-3-10-18/h4-8,11-13,18H,2-3,9-10,14H2,1H3,(H,24,28) |
| InChIKey | WHWFYXDCBYYINH-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |