C17H18ClN3O2S — CID 46525818
2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(cyclopropylmethyl)acetamide (PubChem CID 46525818) has the molecular formula C17H18ClN3O2S and a molecular weight of 363.87 g/mol. Its IUPAC name is 2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(cyclopropylmethyl)acetamide.
| Compound Name | 2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(cyclopropylmethyl)acetamide |
|---|---|
| PubChem CID | 46525818 |
| Molecular Formula | C17H18ClN3O2S |
| Molecular Weight | 363.87 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(cyclopropylmethyl)acetamide |
| SMILES | C=CCn1c(SCC(=O)NCC2CC2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C17H18ClN3O2S/c1-2-7-21-16(23)13-6-5-12(18)8-14(13)20-17(21)24-10-15(22)19-9-11-3-4-11/h2,5-6,8,11H,1,3-4,7,9-10H2,(H,19,22) |
| InChIKey | MDLILXPAUTVWKA-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.87 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|