C19H17ClN4O3S — CID 17485842
N-[2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetyl]-1-methylpyrrole-2-carboxamide (PubChem CID 17485842) has the molecular formula C19H17ClN4O3S and a molecular weight of 416.89 g/mol. Its IUPAC name is N-[2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetyl]-1-methylpyrrole-2-carboxamide.
| Compound Name | N-[2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetyl]-1-methylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 17485842 |
| Molecular Formula | C19H17ClN4O3S |
| Molecular Weight | 416.89 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | N-[2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetyl]-1-methylpyrrole-2-carboxamide |
| SMILES | C=CCn1c(SCC(=O)NC(=O)c2cccn2C)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C19H17ClN4O3S/c1-3-8-24-18(27)13-7-6-12(20)10-14(13)21-19(24)28-11-16(25)22-17(26)15-5-4-9-23(15)2/h3-7,9-10H,1,8,11H2,2H3,(H,22,25,26) |
| InChIKey | TXXIUIWCMOLUKH-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 85.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.89 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|