C20H18ClN3O2S2 — CID 16504882
2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(3-methylsulfanylphenyl)acetamide (PubChem CID 16504882) has the molecular formula C20H18ClN3O2S2 and a molecular weight of 431.97 g/mol. Its IUPAC name is 2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(3-methylsulfanylphenyl)acetamide.
| Compound Name | 2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(3-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 16504882 |
| Molecular Formula | C20H18ClN3O2S2 |
| Molecular Weight | 431.97 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | 2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(3-methylsulfanylphenyl)acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2cccc(SC)c2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C20H18ClN3O2S2/c1-3-9-24-19(26)16-8-7-13(21)10-17(16)23-20(24)28-12-18(25)22-14-5-4-6-15(11-14)27-2/h3-8,10-11H,1,9,12H2,2H3,(H,22,25) |
| InChIKey | IXSOGEFOOXSMDF-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.97 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|