C20H16ClF2N3O2S2 — CID 24593212
2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-[2-(difluoromethylsulfanyl)phenyl]acetamide (PubChem CID 24593212) has the molecular formula C20H16ClF2N3O2S2 and a molecular weight of 467.95 g/mol. Its IUPAC name is 2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-[2-(difluoromethylsulfanyl)phenyl]acetamide.
| Compound Name | 2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-[2-(difluoromethylsulfanyl)phenyl]acetamide |
|---|---|
| PubChem CID | 24593212 |
| Molecular Formula | C20H16ClF2N3O2S2 |
| Molecular Weight | 467.95 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | 2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-[2-(difluoromethylsulfanyl)phenyl]acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccccc2SC(F)F)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C20H16ClF2N3O2S2/c1-2-9-26-18(28)13-8-7-12(21)10-15(13)25-20(26)29-11-17(27)24-14-5-3-4-6-16(14)30-19(22)23/h2-8,10,19H,1,9,11H2,(H,24,27) |
| InChIKey | QJKCHCLFUDUSTO-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.95 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|