C19H14Cl2N4O4S — CID 40928061
N-(2-chloro-4-nitrophenyl)-2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetamide (PubChem CID 40928061) has the molecular formula C19H14Cl2N4O4S and a molecular weight of 465.32 g/mol. Its IUPAC name is N-(2-chloro-4-nitrophenyl)-2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetamide.
| Compound Name | N-(2-chloro-4-nitrophenyl)-2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 40928061 |
| Molecular Formula | C19H14Cl2N4O4S |
| Molecular Weight | 465.32 g/mol |
| Exact Mass | 464.01 |
| IUPAC Name | N-(2-chloro-4-nitrophenyl)-2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2ccc([N+](=O)[O-])cc2Cl)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C19H14Cl2N4O4S/c1-2-7-24-18(27)13-5-3-11(20)8-16(13)23-19(24)30-10-17(26)22-15-6-4-12(25(28)29)9-14(15)21/h2-6,8-9H,1,7,10H2,(H,22,26) |
| InChIKey | HJWPWFUFCQVHLP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.32 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|