C18H20ClN3O4S2 — CID 16504664
2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(3-methyl-1,1-dioxothiolan-3-yl)acetamide (PubChem CID 16504664) has the molecular formula C18H20ClN3O4S2 and a molecular weight of 441.96 g/mol. Its IUPAC name is 2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(3-methyl-1,1-dioxothiolan-3-yl)acetamide.
| Compound Name | 2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(3-methyl-1,1-dioxothiolan-3-yl)acetamide |
|---|---|
| PubChem CID | 16504664 |
| Molecular Formula | C18H20ClN3O4S2 |
| Molecular Weight | 441.96 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | 2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(3-methyl-1,1-dioxothiolan-3-yl)acetamide |
| SMILES | C=CCn1c(SCC(=O)NC2(C)CCS(=O)(=O)C2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C18H20ClN3O4S2/c1-3-7-22-16(24)13-5-4-12(19)9-14(13)20-17(22)27-10-15(23)21-18(2)6-8-28(25,26)11-18/h3-5,9H,1,6-8,10-11H2,2H3,(H,21,23) |
| InChIKey | YDOPZEOFQRZVBV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.96 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|