C19H20ClN5O4S — CID 46607337
2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 46607337) has the molecular formula C19H20ClN5O4S and a molecular weight of 449.92 g/mol. Its IUPAC name is 2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | 2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 46607337 |
| Molecular Formula | C19H20ClN5O4S |
| Molecular Weight | 449.92 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | 2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(4-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | C=CCn1c(SCC(=O)NN2C(=O)NC(C)(CC)C2=O)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C19H20ClN5O4S/c1-4-8-24-15(27)12-7-6-11(20)9-13(12)21-18(24)30-10-14(26)23-25-16(28)19(3,5-2)22-17(25)29/h4,6-7,9H,1,5,8,10H2,2-3H3,(H,22,29)(H,23,26) |
| InChIKey | VLXLCWMSNQQYLL-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.92 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|