C17H19ClN2O3S — CID 55307983
butyl 2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetate (PubChem CID 55307983) has the molecular formula C17H19ClN2O3S and a molecular weight of 366.87 g/mol. Its IUPAC name is butyl 2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetate.
| Compound Name | butyl 2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 55307983 |
| Molecular Formula | C17H19ClN2O3S |
| Molecular Weight | 366.87 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | butyl 2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetate |
| SMILES | C=CCn1c(SCC(=O)OCCCC)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C17H19ClN2O3S/c1-3-5-9-23-15(21)11-24-17-19-14-10-12(18)6-7-13(14)16(22)20(17)8-4-2/h4,6-7,10H,2-3,5,8-9,11H2,1H3 |
| InChIKey | SUOOSDIOAYFWAW-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.87 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|