C20H20ClN5O5S — CID 24567355
6-amino-5-[2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetyl]-1-(2-methoxyethyl)pyrimidine-2,4-dione (PubChem CID 24567355) has the molecular formula C20H20ClN5O5S and a molecular weight of 477.93 g/mol. Its IUPAC name is 6-amino-5-[2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetyl]-1-(2-methoxyethyl)pyrimidine-2,4-dione.
| Compound Name | 6-amino-5-[2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetyl]-1-(2-methoxyethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 24567355 |
| Molecular Formula | C20H20ClN5O5S |
| Molecular Weight | 477.93 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | 6-amino-5-[2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanylacetyl]-1-(2-methoxyethyl)pyrimidine-2,4-dione |
| SMILES | C=CCn1c(SCC(=O)c2c(N)n(CCOC)c(=O)[nH]c2=O)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C20H20ClN5O5S/c1-3-6-26-18(29)12-5-4-11(21)9-13(12)23-20(26)32-10-14(27)15-16(22)25(7-8-31-2)19(30)24-17(15)28/h3-5,9H,1,6-8,10,22H2,2H3,(H,24,28,30) |
| InChIKey | DEJCFCVVAVLSDJ-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 142.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.93 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|