C13H17N7O4S — CID 55997545
6-amino-1-(2-methoxyethyl)-5-[2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetyl]pyrimidine-2,4-dione (PubChem CID 55997545) has the molecular formula C13H17N7O4S and a molecular weight of 367.39 g/mol. Its IUPAC name is 6-amino-1-(2-methoxyethyl)-5-[2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetyl]pyrimidine-2,4-dione.
| Compound Name | 6-amino-1-(2-methoxyethyl)-5-[2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 55997545 |
| Molecular Formula | C13H17N7O4S |
| Molecular Weight | 367.39 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 6-amino-1-(2-methoxyethyl)-5-[2-(1-prop-2-enyltetrazol-5-yl)sulfanylacetyl]pyrimidine-2,4-dione |
| SMILES | C=CCn1nnnc1SCC(=O)c1c(N)n(CCOC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H17N7O4S/c1-3-4-20-13(16-17-18-20)25-7-8(21)9-10(14)19(5-6-24-2)12(23)15-11(9)22/h3H,1,4-7,14H2,2H3,(H,15,22,23) |
| InChIKey | AIWIIIRBSNAJLX-UHFFFAOYSA-N |
| XLogP | -1.09 |
| TPSA | 150.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.39 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|