C16H13ClN4O2S2 — CID 42966334
2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 42966334) has the molecular formula C16H13ClN4O2S2 and a molecular weight of 392.89 g/mol. Its IUPAC name is 2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 42966334 |
| Molecular Formula | C16H13ClN4O2S2 |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | 2-(7-chloro-4-oxo-3-prop-2-enylquinazolin-2-yl)sulfanyl-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | C=CCn1c(SCC(=O)Nc2nccs2)nc2cc(Cl)ccc2c1=O |
| InChI | InChI=1S/C16H13ClN4O2S2/c1-2-6-21-14(23)11-4-3-10(17)8-12(11)19-16(21)25-9-13(22)20-15-18-5-7-24-15/h2-5,7-8H,1,6,9H2,(H,18,20,22) |
| InChIKey | RDGPFCYVORUCMW-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|