C17H13ClN6OS2 — CID 18808615
2-[(8-chloro-5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-(1,3-thiazol-2-yl)acetamide (PubChem CID 18808615) has the molecular formula C17H13ClN6OS2 and a molecular weight of 416.92 g/mol. Its IUPAC name is 2-[(8-chloro-5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-(1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-[(8-chloro-5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-(1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 18808615 |
| Molecular Formula | C17H13ClN6OS2 |
| Molecular Weight | 416.92 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | 2-[(8-chloro-5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-(1,3-thiazol-2-yl)acetamide |
| SMILES | C=CCn1c2ccc(Cl)cc2c2nnc(SCC(=O)Nc3nccs3)nc21 |
| InChI | InChI=1S/C17H13ClN6OS2/c1-2-6-24-12-4-3-10(18)8-11(12)14-15(24)21-17(23-22-14)27-9-13(25)20-16-19-5-7-26-16/h2-5,7-8H,1,6,9H2,(H,19,20,25) |
| InChIKey | XGUVCEDRWPJLOU-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.92 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_thio_656a(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|