C18H15N7OS — CID 5290692
2-[(5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-pyrimidin-2-ylacetamide (PubChem CID 5290692) has the molecular formula C18H15N7OS and a molecular weight of 377.43 g/mol. Its IUPAC name is 2-[(5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-pyrimidin-2-ylacetamide.
| Compound Name | 2-[(5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-pyrimidin-2-ylacetamide |
|---|---|
| PubChem CID | 5290692 |
| Molecular Formula | C18H15N7OS |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 2-[(5-prop-2-enyl-[1,2,4]triazino[5,6-b]indol-3-yl)sulfanyl]-N-pyrimidin-2-ylacetamide |
| SMILES | C=CCn1c2ccccc2c2nnc(SCC(=O)Nc3ncccn3)nc21 |
| InChI | InChI=1S/C18H15N7OS/c1-2-10-25-13-7-4-3-6-12(13)15-16(25)22-18(24-23-15)27-11-14(26)21-17-19-8-5-9-20-17/h2-9H,1,10-11H2,(H,19,20,21,26) |
| InChIKey | IXXDAAKKAFCAEH-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het_thio_656a(5)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|